C20H26BrIN4O2 — CID 111282122
3-bromo-N-[2-[[N-[(2-methoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide (PubChem CID 111282122) has the molecular formula C20H26BrIN4O2 and a molecular weight of 561.26 g/mol. Its IUPAC name is 3-bromo-N-[2-[[N-[(2-methoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide.
| Compound Name | 3-bromo-N-[2-[[N-[(2-methoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111282122 |
| Molecular Formula | C20H26BrIN4O2 |
| Molecular Weight | 561.26 g/mol |
| Exact Mass | 560.03 |
| IUPAC Name | 3-bromo-N-[2-[[N-[(2-methoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]ethyl]benzamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)c1cccc(Br)c1)N(C)Cc1ccccc1OC.I |
| InChI | InChI=1S/C20H25BrN4O2.HI/c1-22-20(25(2)14-16-7-4-5-10-18(16)27-3)24-12-11-23-19(26)15-8-6-9-17(21)13-15;/h4-10,13H,11-12,14H2,1-3H3,(H,22,24)(H,23,26);1H |
| InChIKey | FUPJXAIMNSJAJG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.26 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|