C15H27IN4S — CID 109497793
3-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide (PubChem CID 109497793) has the molecular formula C15H27IN4S and a molecular weight of 422.38 g/mol. Its IUPAC name is 3-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide.
| Compound Name | 3-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109497793 |
| Molecular Formula | C15H27IN4S |
| Molecular Weight | 422.38 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 3-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N\C)NCCc1sc(C)nc1C.I |
| InChI | InChI=1S/C15H26N4S.HI/c1-6-7-8-11-19(5)15(16-4)17-10-9-14-12(2)18-13(3)20-14;/h6H,1,7-11H2,2-5H3,(H,16,17);1H |
| InChIKey | VZVOBJIPDTYZHG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|