C12H25N3O — CID 109498064
3-(3-methoxypropyl)-1,2-dimethyl-1-pent-4-enylguanidine (PubChem CID 109498064) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-1,2-dimethyl-1-pent-4-enylguanidine.
| Compound Name | 3-(3-methoxypropyl)-1,2-dimethyl-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109498064 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 3-(3-methoxypropyl)-1,2-dimethyl-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N/C)NCCCOC |
| InChI | InChI=1S/C12H25N3O/c1-5-6-7-10-15(3)12(13-2)14-9-8-11-16-4/h5H,1,6-11H2,2-4H3,(H,13,14) |
| InChIKey | POFHBTXIWISKGE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|