C15H33IN4 — CID 109498071
3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide (PubChem CID 109498071) has the molecular formula C15H33IN4 and a molecular weight of 396.36 g/mol. Its IUPAC name is 3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide.
| Compound Name | 3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109498071 |
| Molecular Formula | C15H33IN4 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 3-[3-(dimethylamino)-2,2-dimethylpropyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N\C)NCC(C)(C)CN(C)C.I |
| InChI | InChI=1S/C15H32N4.HI/c1-8-9-10-11-19(7)14(16-4)17-12-15(2,3)13-18(5)6;/h8H,1,9-13H2,2-7H3,(H,16,17);1H |
| InChIKey | BKAMVSCSQPURIV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|