C15H31N3O — CID 109498980
3-(3-butoxypropyl)-1,2-dimethyl-1-pent-4-enylguanidine (PubChem CID 109498980) has the molecular formula C15H31N3O and a molecular weight of 269.43 g/mol. Its IUPAC name is 3-(3-butoxypropyl)-1,2-dimethyl-1-pent-4-enylguanidine.
| Compound Name | 3-(3-butoxypropyl)-1,2-dimethyl-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109498980 |
| Molecular Formula | C15H31N3O |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.25 |
| IUPAC Name | 3-(3-butoxypropyl)-1,2-dimethyl-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N/C)NCCCOCCCC |
| InChI | InChI=1S/C15H31N3O/c1-5-7-9-12-18(4)15(16-3)17-11-10-14-19-13-8-6-2/h5H,1,6-14H2,2-4H3,(H,16,17) |
| InChIKey | RGTWIXJGKFDBJB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|