C17H22N2O5 — CID 109499701
N-[1-(furan-2-yl)ethyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]morpholine-4-carboxamide (PubChem CID 109499701) has the molecular formula C17H22N2O5 and a molecular weight of 334.37 g/mol. Its IUPAC name is N-[1-(furan-2-yl)ethyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]morpholine-4-carboxamide.
| Compound Name | N-[1-(furan-2-yl)ethyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 109499701 |
| Molecular Formula | C17H22N2O5 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | N-[1-(furan-2-yl)ethyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]morpholine-4-carboxamide |
| SMILES | CC(NC(=O)N1CCOCC1CC(O)c1ccco1)c1ccco1 |
| InChI | InChI=1S/C17H22N2O5/c1-12(15-4-2-7-23-15)18-17(21)19-6-9-22-11-13(19)10-14(20)16-5-3-8-24-16/h2-5,7-8,12-14,20H,6,9-11H2,1H3,(H,18,21) |
| InChIKey | GNRYVKWZUQAANP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |