C15H24N2O4 — CID 109467720
N-tert-butyl-3-[2-(furan-2-yl)-2-hydroxyethyl]morpholine-4-carboxamide (PubChem CID 109467720) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is N-tert-butyl-3-[2-(furan-2-yl)-2-hydroxyethyl]morpholine-4-carboxamide.
| Compound Name | N-tert-butyl-3-[2-(furan-2-yl)-2-hydroxyethyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 109467720 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N-tert-butyl-3-[2-(furan-2-yl)-2-hydroxyethyl]morpholine-4-carboxamide |
| SMILES | CC(C)(C)NC(=O)N1CCOCC1CC(O)c1ccco1 |
| InChI | InChI=1S/C15H24N2O4/c1-15(2,3)16-14(19)17-6-8-20-10-11(17)9-12(18)13-5-4-7-21-13/h4-5,7,11-12,18H,6,8-10H2,1-3H3,(H,16,19) |
| InChIKey | IMJSAUWKWJWFDD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |