C12H18N2O4 — CID 99718768
(2R)-2-[(2R)-2-(furan-2-yl)-2-hydroxyethyl]-N-methoxypyrrolidine-1-carboxamide (PubChem CID 99718768) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is (2R)-2-[(2R)-2-(furan-2-yl)-2-hydroxyethyl]-N-methoxypyrrolidine-1-carboxamide.
| Compound Name | (2R)-2-[(2R)-2-(furan-2-yl)-2-hydroxyethyl]-N-methoxypyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 99718768 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (2R)-2-[(2R)-2-(furan-2-yl)-2-hydroxyethyl]-N-methoxypyrrolidine-1-carboxamide |
| SMILES | CONC(=O)N1CCC[C@@H]1C[C@@H](O)c1ccco1 |
| InChI | InChI=1S/C12H18N2O4/c1-17-13-12(16)14-6-2-4-9(14)8-10(15)11-5-3-7-18-11/h3,5,7,9-10,15H,2,4,6,8H2,1H3,(H,13,16)/t9-,10-/m1/s1 |
| InChIKey | CMYMNEKCKAADCH-NXEZZACHSA-N |
| XLogP | 1.44 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|