C16H20N2O3S — CID 71920200
2-[2-(furan-2-yl)-2-hydroxyethyl]-N-(thiophen-3-ylmethyl)pyrrolidine-1-carboxamide (PubChem CID 71920200) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)-2-hydroxyethyl]-N-(thiophen-3-ylmethyl)pyrrolidine-1-carboxamide.
| Compound Name | 2-[2-(furan-2-yl)-2-hydroxyethyl]-N-(thiophen-3-ylmethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 71920200 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-[2-(furan-2-yl)-2-hydroxyethyl]-N-(thiophen-3-ylmethyl)pyrrolidine-1-carboxamide |
| SMILES | O=C(NCc1ccsc1)N1CCCC1CC(O)c1ccco1 |
| InChI | InChI=1S/C16H20N2O3S/c19-14(15-4-2-7-21-15)9-13-3-1-6-18(13)16(20)17-10-12-5-8-22-11-12/h2,4-5,7-8,11,13-14,19H,1,3,6,9-10H2,(H,17,20) |
| InChIKey | UXYWUWOZARSOAI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |