C20H37BrO5Si — CID 10950703
2-bromo-1-[(2S,3S)-3-[(2S,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxan-3-yl]oxyoxan-2-yl]ethanone (PubChem CID 10950703) has the molecular formula C20H37BrO5Si and a molecular weight of 465.50 g/mol. Its IUPAC name is 2-bromo-1-[(2S,3S)-3-[(2S,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxan-3-yl]oxyoxan-2-yl]ethanone.
| Compound Name | 2-bromo-1-[(2S,3S)-3-[(2S,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxan-3-yl]oxyoxan-2-yl]ethanone |
|---|---|
| PubChem CID | 10950703 |
| Molecular Formula | C20H37BrO5Si |
| Molecular Weight | 465.50 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 2-bromo-1-[(2S,3S)-3-[(2S,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxan-3-yl]oxyoxan-2-yl]ethanone |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H]1OCCC[C@H]1O[C@H]1CCCO[C@@H]1C(=O)CBr |
| InChI | InChI=1S/C20H37BrO5Si/c1-20(2,3)27(4,5)25-13-10-16-17(8-6-11-23-16)26-18-9-7-12-24-19(18)15(22)14-21/h16-19H,6-14H2,1-5H3/t16-,17+,18-,19+/m0/s1 |
| InChIKey | BGHNPXUOISTUOH-ZSYWTGECSA-N |
| XLogP | 4.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|