C19H36O5Si — CID 11111515
(2S,3S)-3-[(2S,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxan-3-yl]oxyoxane-2-carbaldehyde (PubChem CID 11111515) has the molecular formula C19H36O5Si and a molecular weight of 372.58 g/mol. Its IUPAC name is (2S,3S)-3-[(2S,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxan-3-yl]oxyoxane-2-carbaldehyde.
| Compound Name | (2S,3S)-3-[(2S,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxan-3-yl]oxyoxane-2-carbaldehyde |
|---|---|
| PubChem CID | 11111515 |
| Molecular Formula | C19H36O5Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (2S,3S)-3-[(2S,3R)-2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]oxan-3-yl]oxyoxane-2-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H]1OCCC[C@H]1O[C@H]1CCCO[C@@H]1C=O |
| InChI | InChI=1S/C19H36O5Si/c1-19(2,3)25(4,5)23-13-10-15-16(8-6-11-21-15)24-17-9-7-12-22-18(17)14-20/h14-18H,6-13H2,1-5H3/t15-,16+,17-,18+/m0/s1 |
| InChIKey | AKOXTZMPQALZIX-XWTMOSNGSA-N |
| XLogP | 3.71 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|