C6H6O2 — CID 10953449
(1S,4S)-7-oxabicyclo[2.2.1]hept-5-en-2-one (PubChem CID 10953449) has the molecular formula C6H6O2 and a molecular weight of 110.11 g/mol. Its IUPAC name is (1S,4S)-7-oxabicyclo[2.2.1]hept-5-en-2-one.
| Compound Name | (1S,4S)-7-oxabicyclo[2.2.1]hept-5-en-2-one |
|---|---|
| PubChem CID | 10953449 |
| Molecular Formula | C6H6O2 |
| Molecular Weight | 110.11 g/mol |
| Exact Mass | 110.04 |
| IUPAC Name | (1S,4S)-7-oxabicyclo[2.2.1]hept-5-en-2-one |
| SMILES | O=C1C[C@H]2C=C[C@@H]1O2 |
| InChI | InChI=1S/C6H6O2/c7-5-3-4-1-2-6(5)8-4/h1-2,4,6H,3H2/t4-,6+/m1/s1 |
| InChIKey | UOJMBOVGSKPEHF-XINAWCOVSA-N |
| XLogP | 0.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.11 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|