C12H18N2 — CID 10954357
1-methyl-2-[(1E,5Z)-octa-1,5-dienyl]imidazole (PubChem CID 10954357) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 1-methyl-2-[(1E,5Z)-octa-1,5-dienyl]imidazole.
| Compound Name | 1-methyl-2-[(1E,5Z)-octa-1,5-dienyl]imidazole |
|---|---|
| PubChem CID | 10954357 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 1-methyl-2-[(1E,5Z)-octa-1,5-dienyl]imidazole |
| SMILES | CC/C=C\CC/C=C/c1nccn1C |
| InChI | InChI=1S/C12H18N2/c1-3-4-5-6-7-8-9-12-13-10-11-14(12)2/h4-5,8-11H,3,6-7H2,1-2H3/b5-4-,9-8+ |
| InChIKey | PBEHKGXRXOSEKH-FTGFODROSA-N |
| XLogP | 3.18 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|