C11H18O3 — CID 10954528
(4R,5S)-5-[(Z)-hept-1-enyl]-1,3-dioxolane-4-carbaldehyde (PubChem CID 10954528) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (4R,5S)-5-[(Z)-hept-1-enyl]-1,3-dioxolane-4-carbaldehyde.
| Compound Name | (4R,5S)-5-[(Z)-hept-1-enyl]-1,3-dioxolane-4-carbaldehyde |
|---|---|
| PubChem CID | 10954528 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (4R,5S)-5-[(Z)-hept-1-enyl]-1,3-dioxolane-4-carbaldehyde |
| SMILES | CCCCC/C=C\[C@@H]1OCO[C@H]1C=O |
| InChI | InChI=1S/C11H18O3/c1-2-3-4-5-6-7-10-11(8-12)14-9-13-10/h6-8,10-11H,2-5,9H2,1H3/b7-6-/t10-,11-/m0/s1 |
| InChIKey | MASSSLOCJIMELI-TWHAFNCTSA-N |
| XLogP | 2.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|