C13H18O3 — CID 10955153
(1R,4R,8R,11S,12S)-4-methoxy-12-methyl-3-oxatricyclo[6.3.1.04,11]dodec-9-en-5-one (PubChem CID 10955153) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (1R,4R,8R,11S,12S)-4-methoxy-12-methyl-3-oxatricyclo[6.3.1.04,11]dodec-9-en-5-one.
| Compound Name | (1R,4R,8R,11S,12S)-4-methoxy-12-methyl-3-oxatricyclo[6.3.1.04,11]dodec-9-en-5-one |
|---|---|
| PubChem CID | 10955153 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (1R,4R,8R,11S,12S)-4-methoxy-12-methyl-3-oxatricyclo[6.3.1.04,11]dodec-9-en-5-one |
| SMILES | CO[C@@]12OC[C@@H]3[C@@H](C)[C@@H](C=C[C@@H]31)CCC2=O |
| InChI | InChI=1S/C13H18O3/c1-8-9-3-5-11-10(8)7-16-13(11,15-2)12(14)6-4-9/h3,5,8-11H,4,6-7H2,1-2H3/t8-,9-,10+,11-,13+/m0/s1 |
| InChIKey | YKPWGGAFGPGYBQ-XPORZQOISA-N |
| XLogP | 1.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|