C20H18O3 — CID 10957733
2-(2-ethenylphenyl)-4,4-dimethoxy-3-phenylcyclobut-2-en-1-one (PubChem CID 10957733) has the molecular formula C20H18O3 and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-(2-ethenylphenyl)-4,4-dimethoxy-3-phenylcyclobut-2-en-1-one.
| Compound Name | 2-(2-ethenylphenyl)-4,4-dimethoxy-3-phenylcyclobut-2-en-1-one |
|---|---|
| PubChem CID | 10957733 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 2-(2-ethenylphenyl)-4,4-dimethoxy-3-phenylcyclobut-2-en-1-one |
| SMILES | C=Cc1ccccc1C1=C(c2ccccc2)C(OC)(OC)C1=O |
| InChI | InChI=1S/C20H18O3/c1-4-14-10-8-9-13-16(14)17-18(15-11-6-5-7-12-15)20(22-2,23-3)19(17)21/h4-13H,1H2,2-3H3 |
| InChIKey | HELGSABLNOCSRA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|