C17H30O3Si — CID 10957884
5-[[tert-butyl(dimethyl)silyl]oxymethyl]deca-2,8-diyne-1,10-diol (PubChem CID 10957884) has the molecular formula C17H30O3Si and a molecular weight of 310.51 g/mol. Its IUPAC name is 5-[[tert-butyl(dimethyl)silyl]oxymethyl]deca-2,8-diyne-1,10-diol.
| Compound Name | 5-[[tert-butyl(dimethyl)silyl]oxymethyl]deca-2,8-diyne-1,10-diol |
|---|---|
| PubChem CID | 10957884 |
| Molecular Formula | C17H30O3Si |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 5-[[tert-butyl(dimethyl)silyl]oxymethyl]deca-2,8-diyne-1,10-diol |
| SMILES | CC(C)(C)[Si](C)(C)OCC(CC#CCO)CCC#CCO |
| InChI | InChI=1S/C17H30O3Si/c1-17(2,3)21(4,5)20-15-16(12-8-10-14-19)11-7-6-9-13-18/h16,18-19H,7,11-15H2,1-5H3 |
| InChIKey | LULWOSWPXBFCAS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|