C14H16O5S2 — CID 10958421
4-[4-(benzenesulfonyl)-1,1-dioxo-2,5-dihydrothiophen-2-yl]butanal (PubChem CID 10958421) has the molecular formula C14H16O5S2 and a molecular weight of 328.41 g/mol. Its IUPAC name is 4-[4-(benzenesulfonyl)-1,1-dioxo-2,5-dihydrothiophen-2-yl]butanal.
| Compound Name | 4-[4-(benzenesulfonyl)-1,1-dioxo-2,5-dihydrothiophen-2-yl]butanal |
|---|---|
| PubChem CID | 10958421 |
| Molecular Formula | C14H16O5S2 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 4-[4-(benzenesulfonyl)-1,1-dioxo-2,5-dihydrothiophen-2-yl]butanal |
| SMILES | O=CCCCC1C=C(S(=O)(=O)c2ccccc2)CS1(=O)=O |
| InChI | InChI=1S/C14H16O5S2/c15-9-5-4-8-13-10-14(11-20(13,16)17)21(18,19)12-6-2-1-3-7-12/h1-3,6-7,9-10,13H,4-5,8,11H2 |
| InChIKey | QQMKTWZDZIMVDP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|