C13H25N4O5P — CID 10958987
6-[2-[di(propan-2-yloxy)phosphorylmethoxy]ethoxy]pyrimidine-2,4-diamine (PubChem CID 10958987) has the molecular formula C13H25N4O5P and a molecular weight of 348.34 g/mol. Its IUPAC name is 6-[2-[di(propan-2-yloxy)phosphorylmethoxy]ethoxy]pyrimidine-2,4-diamine.
| Compound Name | 6-[2-[di(propan-2-yloxy)phosphorylmethoxy]ethoxy]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 10958987 |
| Molecular Formula | C13H25N4O5P |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 6-[2-[di(propan-2-yloxy)phosphorylmethoxy]ethoxy]pyrimidine-2,4-diamine |
| SMILES | CC(C)OP(=O)(COCCOc1cc(N)nc(N)n1)OC(C)C |
| InChI | InChI=1S/C13H25N4O5P/c1-9(2)21-23(18,22-10(3)4)8-19-5-6-20-12-7-11(14)16-13(15)17-12/h7,9-10H,5-6,8H2,1-4H3,(H4,14,15,16,17) |
| InChIKey | PXPFACYWCXSPRV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 131.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|