C19H18N2O2Se — CID 10959994
ethyl 5-(benzhydrylamino)-1,3-selenazole-4-carboxylate (PubChem CID 10959994) has the molecular formula C19H18N2O2Se and a molecular weight of 385.33 g/mol. Its IUPAC name is ethyl 5-(benzhydrylamino)-1,3-selenazole-4-carboxylate.
| Compound Name | ethyl 5-(benzhydrylamino)-1,3-selenazole-4-carboxylate |
|---|---|
| PubChem CID | 10959994 |
| Molecular Formula | C19H18N2O2Se |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | ethyl 5-(benzhydrylamino)-1,3-selenazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc[se]c1NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H18N2O2Se/c1-2-23-19(22)17-18(24-13-20-17)21-16(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-13,16,21H,2H2,1H3 |
| InChIKey | GHYHSBQNOSDIEJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|