C22H23N3O4 — CID 155590458
ethyl 2-(benzhydrylamino)-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate (PubChem CID 155590458) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is ethyl 2-(benzhydrylamino)-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate.
| Compound Name | ethyl 2-(benzhydrylamino)-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 155590458 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | ethyl 2-(benzhydrylamino)-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate |
| SMILES | CCOC(=O)c1nc(NC(c2ccccc2)c2ccccc2)n(C)c(=O)c1OC |
| InChI | InChI=1S/C22H23N3O4/c1-4-29-21(27)18-19(28-3)20(26)25(2)22(24-18)23-17(15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14,17H,4H2,1-3H3,(H,23,24) |
| InChIKey | AOIPFVWQQYYJGT-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |