C18H18BrNO3S — CID 10960526
N-[1-(4-bromophenyl)-2-methylidene-3-oxobutyl]-4-methylbenzenesulfonamide (PubChem CID 10960526) has the molecular formula C18H18BrNO3S and a molecular weight of 408.32 g/mol. Its IUPAC name is N-[1-(4-bromophenyl)-2-methylidene-3-oxobutyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[1-(4-bromophenyl)-2-methylidene-3-oxobutyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10960526 |
| Molecular Formula | C18H18BrNO3S |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | N-[1-(4-bromophenyl)-2-methylidene-3-oxobutyl]-4-methylbenzenesulfonamide |
| SMILES | C=C(C(C)=O)C(NS(=O)(=O)c1ccc(C)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H18BrNO3S/c1-12-4-10-17(11-5-12)24(22,23)20-18(13(2)14(3)21)15-6-8-16(19)9-7-15/h4-11,18,20H,2H2,1,3H3 |
| InChIKey | CFAXLDKZEJRSTE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|