C30H54O2 — CID 10961295
(1R,2S,3R,4S)-2,3-bis(dec-9-enyl)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diol (PubChem CID 10961295) has the molecular formula C30H54O2 and a molecular weight of 446.76 g/mol. Its IUPAC name is (1R,2S,3R,4S)-2,3-bis(dec-9-enyl)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diol.
| Compound Name | (1R,2S,3R,4S)-2,3-bis(dec-9-enyl)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diol |
|---|---|
| PubChem CID | 10961295 |
| Molecular Formula | C30H54O2 |
| Molecular Weight | 446.76 g/mol |
| Exact Mass | 446.41 |
| IUPAC Name | (1R,2S,3R,4S)-2,3-bis(dec-9-enyl)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diol |
| SMILES | C=CCCCCCCCC[C@@]1(O)[C@@](O)(CCCCCCCCC=C)[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C30H54O2/c1-6-8-10-12-14-16-18-20-23-29(31)26-22-25-28(5,27(26,3)4)30(29,32)24-21-19-17-15-13-11-9-7-2/h6-7,26,31-32H,1-2,8-25H2,3-5H3/t26-,28+,29+,30-/m0/s1 |
| InChIKey | QYSKLDWWBWCAAM-XQVPNCLKSA-N |
| XLogP | 8.52 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.76 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|