C14H22O2 — CID 22967276
2,3-bis(ethenyl)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diol (PubChem CID 22967276) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diol.
| Compound Name | 2,3-bis(ethenyl)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diol |
|---|---|
| PubChem CID | 22967276 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 2,3-bis(ethenyl)-1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diol |
| SMILES | C=CC1(O)C2CCC(C)(C2(C)C)C1(O)C=C |
| InChI | InChI=1S/C14H22O2/c1-6-13(15)10-8-9-12(5,11(10,3)4)14(13,16)7-2/h6-7,10,15-16H,1-2,8-9H2,3-5H3 |
| InChIKey | OAYFXIYCAGAXSP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|