C12H20O — CID 14811582
(1R,2R,4S)-2-ethenyl-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 14811582) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (1R,2R,4S)-2-ethenyl-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R,2R,4S)-2-ethenyl-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 14811582 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (1R,2R,4S)-2-ethenyl-1,3,3-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | C=C[C@]1(O)C(C)(C)[C@H]2CC[C@]1(C)C2 |
| InChI | InChI=1S/C12H20O/c1-5-12(13)10(2,3)9-6-7-11(12,4)8-9/h5,9,13H,1,6-8H2,2-4H3/t9-,11+,12-/m0/s1 |
| InChIKey | XTNARWAFRJKDHG-WCQGTBRESA-N |
| XLogP | 2.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|