C11H20N2 — CID 10961644
1,3-ditert-butyl-2H-imidazol-1-ium-2-ide (PubChem CID 10961644) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 1,3-ditert-butyl-2H-imidazol-1-ium-2-ide.
| Compound Name | 1,3-ditert-butyl-2H-imidazol-1-ium-2-ide |
|---|---|
| PubChem CID | 10961644 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1,3-ditert-butyl-2H-imidazol-1-ium-2-ide |
| SMILES | CC(C)(C)n1[c-][n+](C(C)(C)C)cc1 |
| InChI | InChI=1S/C11H20N2/c1-10(2,3)12-7-8-13(9-12)11(4,5)6/h7-8H,1-6H3 |
| InChIKey | FENRCIKTFREPGS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|