About CID 15533103
CID 15533103 (PubChem CID 15533103) has the molecular formula C11H21N2
and a molecular weight of 181.30 g/mol.
Molecular Properties
| Compound Name | CID 15533103 |
| PubChem CID | 15533103 |
| Molecular Formula | C11H21N2 |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.17 |
| IUPAC Name | — |
| SMILES | CC(C)(C)N1[CH]N(C(C)(C)C)C=C1 |
| InChI | InChI=1S/C11H21N2/c1-10(2,3)12-7-8-13(9-12)11(4,5)6/h7-9H,1-6H3 |
| InChIKey | XMGVRIUQAQAOLY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 15533103 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 15533103?
The IUPAC name of CID 15533103 (CID 15533103) is not available.
What is the SMILES notation for CID 15533103?
The canonical SMILES for CID 15533103 is CC(C)(C)N1[CH]N(C(C)(C)C)C=C1.
What is the InChIKey of CID 15533103?
The InChIKey is XMGVRIUQAQAOLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N2/c1-10(2,3)12-7-8-13(9-12)11(4,5)6/h7-9H,1-6H3.
What are the key properties of CID 15533103?
CID 15533103 has a molecular weight of 181.30 g/mol, XLogP of 2.79, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 15533103 is sourced from PubChem (CID 15533103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).