C27H43NO4S — CID 10961803
[(1R,2R,4S)-1-[di(propan-2-yl)sulfamoylmethyl]-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5-phenylpentanoate (PubChem CID 10961803) has the molecular formula C27H43NO4S and a molecular weight of 477.71 g/mol. Its IUPAC name is [(1R,2R,4S)-1-[di(propan-2-yl)sulfamoylmethyl]-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5-phenylpentanoate.
| Compound Name | [(1R,2R,4S)-1-[di(propan-2-yl)sulfamoylmethyl]-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5-phenylpentanoate |
|---|---|
| PubChem CID | 10961803 |
| Molecular Formula | C27H43NO4S |
| Molecular Weight | 477.71 g/mol |
| Exact Mass | 477.29 |
| IUPAC Name | [(1R,2R,4S)-1-[di(propan-2-yl)sulfamoylmethyl]-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl] 5-phenylpentanoate |
| SMILES | CC(C)N(C(C)C)S(=O)(=O)C[C@@]12CC[C@@H](C[C@H]1OC(=O)CCCCc1ccccc1)C2(C)C |
| InChI | InChI=1S/C27H43NO4S/c1-20(2)28(21(3)4)33(30,31)19-27-17-16-23(26(27,5)6)18-24(27)32-25(29)15-11-10-14-22-12-8-7-9-13-22/h7-9,12-13,20-21,23-24H,10-11,14-19H2,1-6H3/t23-,24+,27-/m0/s1 |
| InChIKey | YKKUXOKWAZASPD-XFAFFCHDSA-N |
| XLogP | 5.59 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.71 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|