C20H43NO4S2Si2 — CID 10961876
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-trimethylsilyl-N-(2-trimethylsilylethylsulfonyl)ethanesulfonamide (PubChem CID 10961876) has the molecular formula C20H43NO4S2Si2 and a molecular weight of 481.87 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-trimethylsilyl-N-(2-trimethylsilylethylsulfonyl)ethanesulfonamide.
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-trimethylsilyl-N-(2-trimethylsilylethylsulfonyl)ethanesulfonamide |
|---|---|
| PubChem CID | 10961876 |
| Molecular Formula | C20H43NO4S2Si2 |
| Molecular Weight | 481.87 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-trimethylsilyl-N-(2-trimethylsilylethylsulfonyl)ethanesulfonamide |
| SMILES | CC(C)=CCC/C(C)=C/CN(S(=O)(=O)CC[Si](C)(C)C)S(=O)(=O)CC[Si](C)(C)C |
| InChI | InChI=1S/C20H43NO4S2Si2/c1-19(2)11-10-12-20(3)13-14-21(26(22,23)15-17-28(4,5)6)27(24,25)16-18-29(7,8)9/h11,13H,10,12,14-18H2,1-9H3/b20-13+ |
| InChIKey | CHIZMXNSCUJIQT-DEDYPNTBSA-N |
| XLogP | 5.32 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.87 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|