C20H45NO4S2Si2 — CID 11762623
N-(3,7-dimethyloct-6-enyl)-2-trimethylsilyl-N-(2-trimethylsilylethylsulfonyl)ethanesulfonamide (PubChem CID 11762623) has the molecular formula C20H45NO4S2Si2 and a molecular weight of 483.89 g/mol. Its IUPAC name is N-(3,7-dimethyloct-6-enyl)-2-trimethylsilyl-N-(2-trimethylsilylethylsulfonyl)ethanesulfonamide.
| Compound Name | N-(3,7-dimethyloct-6-enyl)-2-trimethylsilyl-N-(2-trimethylsilylethylsulfonyl)ethanesulfonamide |
|---|---|
| PubChem CID | 11762623 |
| Molecular Formula | C20H45NO4S2Si2 |
| Molecular Weight | 483.89 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | N-(3,7-dimethyloct-6-enyl)-2-trimethylsilyl-N-(2-trimethylsilylethylsulfonyl)ethanesulfonamide |
| SMILES | CC(C)=CCCC(C)CCN(S(=O)(=O)CC[Si](C)(C)C)S(=O)(=O)CC[Si](C)(C)C |
| InChI | InChI=1S/C20H45NO4S2Si2/c1-19(2)11-10-12-20(3)13-14-21(26(22,23)15-17-28(4,5)6)27(24,25)16-18-29(7,8)9/h11,20H,10,12-18H2,1-9H3 |
| InChIKey | FUWFPJRQQVFWFX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.89 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|