C21H43NO4S2Si2 — CID 11762741
N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-2-trimethylsilyl-N-(2-trimethylsilylethylsulfonyl)ethanesulfonamide (PubChem CID 11762741) has the molecular formula C21H43NO4S2Si2 and a molecular weight of 493.88 g/mol. Its IUPAC name is N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-2-trimethylsilyl-N-(2-trimethylsilylethylsulfonyl)ethanesulfonamide.
| Compound Name | N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-2-trimethylsilyl-N-(2-trimethylsilylethylsulfonyl)ethanesulfonamide |
|---|---|
| PubChem CID | 11762741 |
| Molecular Formula | C21H43NO4S2Si2 |
| Molecular Weight | 493.88 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | N-[2-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]ethyl]-2-trimethylsilyl-N-(2-trimethylsilylethylsulfonyl)ethanesulfonamide |
| SMILES | CC1(C)[C@H]2CC=C(CCN(S(=O)(=O)CC[Si](C)(C)C)S(=O)(=O)CC[Si](C)(C)C)[C@@H]1C2 |
| InChI | InChI=1S/C21H43NO4S2Si2/c1-21(2)19-10-9-18(20(21)17-19)11-12-22(27(23,24)13-15-29(3,4)5)28(25,26)14-16-30(6,7)8/h9,19-20H,10-17H2,1-8H3/t19-,20-/m0/s1 |
| InChIKey | LLOLWSDHSMVTDR-PMACEKPBSA-N |
| XLogP | 5.01 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.88 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|