C33H49NO4Si — CID 10962669
tert-butyl (4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(E,2R)-hex-4-en-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 10962669) has the molecular formula C33H49NO4Si and a molecular weight of 551.84 g/mol. Its IUPAC name is tert-butyl (4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(E,2R)-hex-4-en-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(E,2R)-hex-4-en-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10962669 |
| Molecular Formula | C33H49NO4Si |
| Molecular Weight | 551.84 g/mol |
| Exact Mass | 551.34 |
| IUPAC Name | tert-butyl (4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[(E,2R)-hex-4-en-2-yl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C/C=C/C[C@@H](C)[C@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H49NO4Si/c1-11-12-19-25(2)29-28(34(33(9,10)37-29)30(35)38-31(3,4)5)24-36-39(32(6,7)8,26-20-15-13-16-21-26)27-22-17-14-18-23-27/h11-18,20-23,25,28-29H,19,24H2,1-10H3/b12-11+/t25-,28-,29-/m1/s1 |
| InChIKey | BHDNUNWPIHUUSY-MXEJQVKFSA-N |
| XLogP | 6.91 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.84 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|