C31H30N4O3S2 — CID 10962838
tert-butyl (1R,2S,5R)-2-[4-(1,3-benzothiazol-2-yl)phenyl]sulfanyl-5-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]cyclopentane-1-carboxylate (PubChem CID 10962838) has the molecular formula C31H30N4O3S2 and a molecular weight of 570.74 g/mol. Its IUPAC name is tert-butyl (1R,2S,5R)-2-[4-(1,3-benzothiazol-2-yl)phenyl]sulfanyl-5-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]cyclopentane-1-carboxylate.
| Compound Name | tert-butyl (1R,2S,5R)-2-[4-(1,3-benzothiazol-2-yl)phenyl]sulfanyl-5-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 10962838 |
| Molecular Formula | C31H30N4O3S2 |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | tert-butyl (1R,2S,5R)-2-[4-(1,3-benzothiazol-2-yl)phenyl]sulfanyl-5-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]cyclopentane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1[C@H](Cn2nnc3ccccc3c2=O)CC[C@@H]1Sc1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C31H30N4O3S2/c1-31(2,3)38-30(37)27-20(18-35-29(36)22-8-4-5-9-23(22)33-34-35)14-17-26(27)39-21-15-12-19(13-16-21)28-32-24-10-6-7-11-25(24)40-28/h4-13,15-16,20,26-27H,14,17-18H2,1-3H3/t20-,26-,27-/m0/s1 |
| InChIKey | HUPBHPAUIJHMMD-RZDWPUGNSA-N |
| XLogP | 6.60 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |