C21H29N3O4Si — CID 140783448
2-trimethylsilylethyl 2-acetyl-5-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]cyclopentane-1-carboxylate (PubChem CID 140783448) has the molecular formula C21H29N3O4Si and a molecular weight of 415.57 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-acetyl-5-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]cyclopentane-1-carboxylate.
| Compound Name | 2-trimethylsilylethyl 2-acetyl-5-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 140783448 |
| Molecular Formula | C21H29N3O4Si |
| Molecular Weight | 415.57 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 2-trimethylsilylethyl 2-acetyl-5-[(4-oxo-1,2,3-benzotriazin-3-yl)methyl]cyclopentane-1-carboxylate |
| SMILES | CC(=O)C1CCC(Cn2nnc3ccccc3c2=O)C1C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C21H29N3O4Si/c1-14(25)16-10-9-15(19(16)21(27)28-11-12-29(2,3)4)13-24-20(26)17-7-5-6-8-18(17)22-23-24/h5-8,15-16,19H,9-13H2,1-4H3 |
| InChIKey | RUXPEMMGVXKAPD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 91.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.57 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|