C37H40F3N3O6Si — CID 140783446
2-trimethylsilylethyl (1S,2S,5R)-2-[hydroxy-[5-(2-phenylethoxy)-1-benzofuran-2-yl]methyl]-5-[[4-oxo-6-(trifluoromethyl)-1,2,3-benzotriazin-3-yl]methyl]cyclopentane-1-carboxylate (PubChem CID 140783446) has the molecular formula C37H40F3N3O6Si and a molecular weight of 707.82 g/mol. Its IUPAC name is 2-trimethylsilylethyl (1S,2S,5R)-2-[hydroxy-[5-(2-phenylethoxy)-1-benzofuran-2-yl]methyl]-5-[[4-oxo-6-(trifluoromethyl)-1,2,3-benzotriazin-3-yl]methyl]cyclopentane-1-carboxylate.
| Compound Name | 2-trimethylsilylethyl (1S,2S,5R)-2-[hydroxy-[5-(2-phenylethoxy)-1-benzofuran-2-yl]methyl]-5-[[4-oxo-6-(trifluoromethyl)-1,2,3-benzotriazin-3-yl]methyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 140783446 |
| Molecular Formula | C37H40F3N3O6Si |
| Molecular Weight | 707.82 g/mol |
| Exact Mass | 707.26 |
| IUPAC Name | 2-trimethylsilylethyl (1S,2S,5R)-2-[hydroxy-[5-(2-phenylethoxy)-1-benzofuran-2-yl]methyl]-5-[[4-oxo-6-(trifluoromethyl)-1,2,3-benzotriazin-3-yl]methyl]cyclopentane-1-carboxylate |
| SMILES | C[Si](C)(C)CCOC(=O)[C@H]1[C@H](Cn2nnc3ccc(C(F)(F)F)cc3c2=O)CC[C@@H]1C(O)c1cc2cc(OCCc3ccccc3)ccc2o1 |
| InChI | InChI=1S/C37H40F3N3O6Si/c1-50(2,3)18-17-48-36(46)33-24(22-43-35(45)29-21-26(37(38,39)40)10-13-30(29)41-42-43)9-12-28(33)34(44)32-20-25-19-27(11-14-31(25)49-32)47-16-15-23-7-5-4-6-8-23/h4-8,10-11,13-14,19-21,24,28,33-34,44H,9,12,15-18,22H2,1-3H3/t24-,28-,33-,34?/m0/s1 |
| InChIKey | MILDSTRZFYTPFO-QIAPNISPSA-N |
| XLogP | 7.44 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.82 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|