C31H42O8S — CID 10962869
[(E,4S)-4-[1-(benzenesulfonyl)-2-oxononan-3-yl]oxy-6-phenylmethoxyhex-2-enyl] ethyl carbonate (PubChem CID 10962869) has the molecular formula C31H42O8S and a molecular weight of 574.74 g/mol. Its IUPAC name is [(E,4S)-4-[1-(benzenesulfonyl)-2-oxononan-3-yl]oxy-6-phenylmethoxyhex-2-enyl] ethyl carbonate.
| Compound Name | [(E,4S)-4-[1-(benzenesulfonyl)-2-oxononan-3-yl]oxy-6-phenylmethoxyhex-2-enyl] ethyl carbonate |
|---|---|
| PubChem CID | 10962869 |
| Molecular Formula | C31H42O8S |
| Molecular Weight | 574.74 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | [(E,4S)-4-[1-(benzenesulfonyl)-2-oxononan-3-yl]oxy-6-phenylmethoxyhex-2-enyl] ethyl carbonate |
| SMILES | CCCCCCC(O[C@H](/C=C/COC(=O)OCC)CCOCc1ccccc1)C(=O)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H42O8S/c1-3-5-6-13-20-30(29(32)25-40(34,35)28-18-11-8-12-19-28)39-27(17-14-22-38-31(33)37-4-2)21-23-36-24-26-15-9-7-10-16-26/h7-12,14-19,27,30H,3-6,13,20-25H2,1-2H3/b17-14+/t27-,30?/m1/s1 |
| InChIKey | LLTSFQBIGVELHG-YYXVAJJASA-N |
| XLogP | 6.09 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.74 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|