C37H40O6S2 — CID 10963304
O-ethyl [(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]sulfanylmethanethioate (PubChem CID 10963304) has the molecular formula C37H40O6S2 and a molecular weight of 644.86 g/mol. Its IUPAC name is O-ethyl [(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]sulfanylmethanethioate.
| Compound Name | O-ethyl [(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 10963304 |
| Molecular Formula | C37H40O6S2 |
| Molecular Weight | 644.86 g/mol |
| Exact Mass | 644.23 |
| IUPAC Name | O-ethyl [(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]sulfanylmethanethioate |
| SMILES | CCOC(=S)S[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C37H40O6S2/c1-2-39-37(44)45-36-35(42-26-31-21-13-6-14-22-31)34(41-25-30-19-11-5-12-20-30)33(40-24-29-17-9-4-10-18-29)32(43-36)27-38-23-28-15-7-3-8-16-28/h3-22,32-36H,2,23-27H2,1H3/t32-,33-,34+,35-,36+/m1/s1 |
| InChIKey | GCTIZRZKVVWEMO-GJXDWMKPSA-N |
| XLogP | 7.74 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.86 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|