C10H16O4 — CID 10965524
methyl (E,3R,4R)-3-hydroxy-3,4-dimethyl-2-oxohept-5-enoate (PubChem CID 10965524) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is methyl (E,3R,4R)-3-hydroxy-3,4-dimethyl-2-oxohept-5-enoate.
| Compound Name | methyl (E,3R,4R)-3-hydroxy-3,4-dimethyl-2-oxohept-5-enoate |
|---|---|
| PubChem CID | 10965524 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | methyl (E,3R,4R)-3-hydroxy-3,4-dimethyl-2-oxohept-5-enoate |
| SMILES | C/C=C/[C@@H](C)[C@@](C)(O)C(=O)C(=O)OC |
| InChI | InChI=1S/C10H16O4/c1-5-6-7(2)10(3,13)8(11)9(12)14-4/h5-7,13H,1-4H3/b6-5+/t7-,10-/m1/s1 |
| InChIKey | BWCHPOPLZTYRGG-JVVNSHGZSA-N |
| XLogP | 0.69 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|