C9H14O4 — CID 10877829
methyl (E,3R)-3-hydroxy-3-methyl-2-oxohept-5-enoate (PubChem CID 10877829) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is methyl (E,3R)-3-hydroxy-3-methyl-2-oxohept-5-enoate.
| Compound Name | methyl (E,3R)-3-hydroxy-3-methyl-2-oxohept-5-enoate |
|---|---|
| PubChem CID | 10877829 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | methyl (E,3R)-3-hydroxy-3-methyl-2-oxohept-5-enoate |
| SMILES | C/C=C/C[C@@](C)(O)C(=O)C(=O)OC |
| InChI | InChI=1S/C9H14O4/c1-4-5-6-9(2,12)7(10)8(11)13-3/h4-5,12H,6H2,1-3H3/b5-4+/t9-/m1/s1 |
| InChIKey | NGQJWBVHCQRXLK-XNPJLODASA-N |
| XLogP | 0.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|