C10H16O4 — CID 58196025
(3R)-3-acetyl-3-hydroxy-6-methylhept-5-enoic acid (PubChem CID 58196025) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (3R)-3-acetyl-3-hydroxy-6-methylhept-5-enoic acid.
| Compound Name | (3R)-3-acetyl-3-hydroxy-6-methylhept-5-enoic acid |
|---|---|
| PubChem CID | 58196025 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (3R)-3-acetyl-3-hydroxy-6-methylhept-5-enoic acid |
| SMILES | CC(=O)[C@@](O)(CC=C(C)C)CC(=O)O |
| InChI | InChI=1S/C10H16O4/c1-7(2)4-5-10(14,8(3)11)6-9(12)13/h4,14H,5-6H2,1-3H3,(H,12,13)/t10-/m1/s1 |
| InChIKey | UKMQGHPEFQXDPI-SNVBAGLBSA-N |
| XLogP | 1.14 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|