C19H25ClN2O — CID 1096606
1-[(3-chlorophenyl)methyl]-N,N-bis(prop-2-enyl)piperidine-4-carboxamide (PubChem CID 1096606) has the molecular formula C19H25ClN2O and a molecular weight of 332.88 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-N,N-bis(prop-2-enyl)piperidine-4-carboxamide.
| Compound Name | 1-[(3-chlorophenyl)methyl]-N,N-bis(prop-2-enyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 1096606 |
| Molecular Formula | C19H25ClN2O |
| Molecular Weight | 332.88 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-N,N-bis(prop-2-enyl)piperidine-4-carboxamide |
| SMILES | C=CCN(CC=C)C(=O)C1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H25ClN2O/c1-3-10-22(11-4-2)19(23)17-8-12-21(13-9-17)15-16-6-5-7-18(20)14-16/h3-7,14,17H,1-2,8-13,15H2 |
| InChIKey | CITRPVCYKJGNHN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.88 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|