C10H13NO3S — CID 10966231
(2S)-2-hydroxy-3-[(R)-(4-methylphenyl)sulfinyl]propanamide (PubChem CID 10966231) has the molecular formula C10H13NO3S and a molecular weight of 227.29 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-[(R)-(4-methylphenyl)sulfinyl]propanamide.
| Compound Name | (2S)-2-hydroxy-3-[(R)-(4-methylphenyl)sulfinyl]propanamide |
|---|---|
| PubChem CID | 10966231 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | (2S)-2-hydroxy-3-[(R)-(4-methylphenyl)sulfinyl]propanamide |
| SMILES | Cc1ccc([S@](=O)C[C@@H](O)C(N)=O)cc1 |
| InChI | InChI=1S/C10H13NO3S/c1-7-2-4-8(5-3-7)15(14)6-9(12)10(11)13/h2-5,9,12H,6H2,1H3,(H2,11,13)/t9-,15-/m1/s1 |
| InChIKey | GONSLKNXQLLZGW-RFAUZJTJSA-N |
| XLogP | -0.05 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |