C10H9FN2O2S — CID 143421569
(2R)-3-(4-cyano-3-fluorophenyl)sulfanyl-2-hydroxypropanamide (PubChem CID 143421569) has the molecular formula C10H9FN2O2S and a molecular weight of 240.26 g/mol. Its IUPAC name is (2R)-3-(4-cyano-3-fluorophenyl)sulfanyl-2-hydroxypropanamide.
| Compound Name | (2R)-3-(4-cyano-3-fluorophenyl)sulfanyl-2-hydroxypropanamide |
|---|---|
| PubChem CID | 143421569 |
| Molecular Formula | C10H9FN2O2S |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | (2R)-3-(4-cyano-3-fluorophenyl)sulfanyl-2-hydroxypropanamide |
| SMILES | N#Cc1ccc(SC[C@H](O)C(N)=O)cc1F |
| InChI | InChI=1S/C10H9FN2O2S/c11-8-3-7(2-1-6(8)4-12)16-5-9(14)10(13)15/h1-3,9,14H,5H2,(H2,13,15)/t9-/m0/s1 |
| InChIKey | IHQUIURLIRYGAT-VIFPVBQESA-N |
| XLogP | 0.64 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |