C11H11Cl2NO — CID 10966750
3,3-dichloro-4-methyl-1-phenylpyrrolidin-2-one (PubChem CID 10966750) has the molecular formula C11H11Cl2NO and a molecular weight of 244.12 g/mol. Its IUPAC name is 3,3-dichloro-4-methyl-1-phenylpyrrolidin-2-one.
| Compound Name | 3,3-dichloro-4-methyl-1-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 10966750 |
| Molecular Formula | C11H11Cl2NO |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 3,3-dichloro-4-methyl-1-phenylpyrrolidin-2-one |
| SMILES | CC1CN(c2ccccc2)C(=O)C1(Cl)Cl |
| InChI | InChI=1S/C11H11Cl2NO/c1-8-7-14(10(15)11(8,12)13)9-5-3-2-4-6-9/h2-6,8H,7H2,1H3 |
| InChIKey | OOYXZQMUWQFFDI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|