C17H19NO — CID 23629147
(3aS,5aS,9aS)-2-phenyl-3a,4,5,5a,6,7-hexahydro-3H-indeno[1,7a-c]pyrrol-1-one (PubChem CID 23629147) has the molecular formula C17H19NO and a molecular weight of 253.35 g/mol. Its IUPAC name is (3aS,5aS,9aS)-2-phenyl-3a,4,5,5a,6,7-hexahydro-3H-indeno[1,7a-c]pyrrol-1-one.
| Compound Name | (3aS,5aS,9aS)-2-phenyl-3a,4,5,5a,6,7-hexahydro-3H-indeno[1,7a-c]pyrrol-1-one |
|---|---|
| PubChem CID | 23629147 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (3aS,5aS,9aS)-2-phenyl-3a,4,5,5a,6,7-hexahydro-3H-indeno[1,7a-c]pyrrol-1-one |
| SMILES | O=C1N(c2ccccc2)C[C@H]2CC[C@@H]3CCC=C[C@@]132 |
| InChI | InChI=1S/C17H19NO/c19-16-17-11-5-4-6-13(17)9-10-14(17)12-18(16)15-7-2-1-3-8-15/h1-3,5,7-8,11,13-14H,4,6,9-10,12H2/t13-,14+,17+/m0/s1 |
| InChIKey | GPAQIIBJANKWTJ-JJRVBVJISA-N |
| XLogP | 3.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|