C21H19ClN2O2S — CID 25243419
(3S,3aS,7aS)-2-(benzenesulfonyl)-3-(4-chlorophenyl)-3,6,7,7a-tetrahydro-1H-isoindole-3a-carbonitrile (PubChem CID 25243419) has the molecular formula C21H19ClN2O2S and a molecular weight of 398.92 g/mol. Its IUPAC name is (3S,3aS,7aS)-2-(benzenesulfonyl)-3-(4-chlorophenyl)-3,6,7,7a-tetrahydro-1H-isoindole-3a-carbonitrile.
| Compound Name | (3S,3aS,7aS)-2-(benzenesulfonyl)-3-(4-chlorophenyl)-3,6,7,7a-tetrahydro-1H-isoindole-3a-carbonitrile |
|---|---|
| PubChem CID | 25243419 |
| Molecular Formula | C21H19ClN2O2S |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | (3S,3aS,7aS)-2-(benzenesulfonyl)-3-(4-chlorophenyl)-3,6,7,7a-tetrahydro-1H-isoindole-3a-carbonitrile |
| SMILES | N#C[C@@]12C=CCC[C@@H]1CN(S(=O)(=O)c1ccccc1)[C@H]2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H19ClN2O2S/c22-18-11-9-16(10-12-18)20-21(15-23)13-5-4-6-17(21)14-24(20)27(25,26)19-7-2-1-3-8-19/h1-3,5,7-13,17,20H,4,6,14H2/t17-,20+,21+/m1/s1 |
| InChIKey | RFSUEJGKHHQYGK-QMMLZNLJSA-N |
| XLogP | 4.56 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|