C15H22O3 — CID 10966924
methyl (E)-3-(1-methyl-2-oxo-3-pentylcyclopent-3-en-1-yl)prop-2-enoate (PubChem CID 10966924) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is methyl (E)-3-(1-methyl-2-oxo-3-pentylcyclopent-3-en-1-yl)prop-2-enoate.
| Compound Name | methyl (E)-3-(1-methyl-2-oxo-3-pentylcyclopent-3-en-1-yl)prop-2-enoate |
|---|---|
| PubChem CID | 10966924 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | methyl (E)-3-(1-methyl-2-oxo-3-pentylcyclopent-3-en-1-yl)prop-2-enoate |
| SMILES | CCCCCC1=CCC(C)(/C=C/C(=O)OC)C1=O |
| InChI | InChI=1S/C15H22O3/c1-4-5-6-7-12-8-10-15(2,14(12)17)11-9-13(16)18-3/h8-9,11H,4-7,10H2,1-3H3/b11-9+ |
| InChIKey | GMBNMMRGAGPHPX-PKNBQFBNSA-N |
| XLogP | 3.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|