C10H9BrN2O3 — CID 10968064
(4R)-2-(2-bromophenyl)-N-hydroxy-4,5-dihydro-1,3-oxazole-4-carboxamide (PubChem CID 10968064) has the molecular formula C10H9BrN2O3 and a molecular weight of 285.10 g/mol. Its IUPAC name is (4R)-2-(2-bromophenyl)-N-hydroxy-4,5-dihydro-1,3-oxazole-4-carboxamide.
| Compound Name | (4R)-2-(2-bromophenyl)-N-hydroxy-4,5-dihydro-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 10968064 |
| Molecular Formula | C10H9BrN2O3 |
| Molecular Weight | 285.10 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | (4R)-2-(2-bromophenyl)-N-hydroxy-4,5-dihydro-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NO)[C@H]1COC(c2ccccc2Br)=N1 |
| InChI | InChI=1S/C10H9BrN2O3/c11-7-4-2-1-3-6(7)10-12-8(5-16-10)9(14)13-15/h1-4,8,15H,5H2,(H,13,14)/t8-/m1/s1 |
| InChIKey | RLINXXZQMRJARL-MRVPVSSYSA-N |
| XLogP | 1.10 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.10 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|