C14H16N2O3S — CID 10968315
(4S)-2-(4-but-3-enoxyphenyl)-N-hydroxy-4,5-dihydro-1,3-thiazole-4-carboxamide (PubChem CID 10968315) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is (4S)-2-(4-but-3-enoxyphenyl)-N-hydroxy-4,5-dihydro-1,3-thiazole-4-carboxamide.
| Compound Name | (4S)-2-(4-but-3-enoxyphenyl)-N-hydroxy-4,5-dihydro-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 10968315 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | (4S)-2-(4-but-3-enoxyphenyl)-N-hydroxy-4,5-dihydro-1,3-thiazole-4-carboxamide |
| SMILES | C=CCCOc1ccc(C2=N[C@@H](C(=O)NO)CS2)cc1 |
| InChI | InChI=1S/C14H16N2O3S/c1-2-3-8-19-11-6-4-10(5-7-11)14-15-12(9-20-14)13(17)16-18/h2,4-7,12,18H,1,3,8-9H2,(H,16,17)/t12-/m1/s1 |
| InChIKey | XYKYFJMHLQAEBE-GFCCVEGCSA-N |
| XLogP | 2.01 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|