C13H17NO2S — CID 59143759
2-(4-butoxyphenyl)-4,5-dihydro-1,3-thiazol-4-ol (PubChem CID 59143759) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-4,5-dihydro-1,3-thiazol-4-ol.
| Compound Name | 2-(4-butoxyphenyl)-4,5-dihydro-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 59143759 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 2-(4-butoxyphenyl)-4,5-dihydro-1,3-thiazol-4-ol |
| SMILES | CCCCOc1ccc(C2=NC(O)CS2)cc1 |
| InChI | InChI=1S/C13H17NO2S/c1-2-3-8-16-11-6-4-10(5-7-11)13-14-12(15)9-17-13/h4-7,12,15H,2-3,8-9H2,1H3 |
| InChIKey | MEENWWCPODQCGF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|